Difference between revisions of "Chalcones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...")
(Created page with "Category:metabolite == Metabolite Chalcones == * common-name: ** a chalcone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-133 ==
+
== Metabolite Chalcones ==
 
* common-name:
 
* common-name:
** violaxanthin
+
** a chalcone
* smiles:
 
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
 
* inchi-key:
 
** szcbxwmuopqsox-wvjdlnglsa-n
 
* molecular-weight:
 
** 600.88
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[RXN-7984]]
 
* [[RXN1F-155]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[RXN-7979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=violaxanthin}}
+
{{#set: common-name=a chalcone}}
{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
 
{{#set: molecular-weight=600.88}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Chalcones

  • common-name:
    • a chalcone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality