Difference between revisions of "Chalcones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite Chalcones == * common-name: ** a chalcone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) kno...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ITP ==
+
== Metabolite Chalcones ==
 
* common-name:
 
* common-name:
** itp
+
** a chalcone
* smiles:
 
** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
** haejpqiatwhalx-kqynxxcusa-j
 
* molecular-weight:
 
** 504.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATP-DEAMINASE-RXN]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[ITCY]]
 
* [[ITPP]]
 
* [[ITUP]]
 
* [[RXN-14120]]
 
* [[RXN0-5073]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATID]]
+
* [[CHALCONE-ISOMERASE-RXN]]
* [[ATIDm]]
 
* [[ATP-DEAMINASE-RXN]]
 
* [[RXN-14120]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=itp}}
+
{{#set: common-name=a chalcone}}
{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
 
{{#set: molecular-weight=504.137}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Chalcones

  • common-name:
    • a chalcone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality