Difference between revisions of "Chalcones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * common-name: ** d-erythro-imidazole-glycerol-phosphate * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-10330 == * common-name: ** α-d-ribofuranose * smiles: ** c(c1(c(c(c(o1)o)o)o))o * inchi-key: ** hmfhbzshggewlo-aihaylrmsa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P ==
+
== Metabolite CPD-10330 ==
 
* common-name:
 
* common-name:
** d-erythro-imidazole-glycerol-phosphate
+
** α-d-ribofuranose
 
* smiles:
 
* smiles:
** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
+
** c(c1(c(c(c(o1)o)o)o))o
 
* inchi-key:
 
* inchi-key:
** hfybthcypkedqq-ritpcoansa-l
+
** hmfhbzshggewlo-aihaylrmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 236.121
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[IGPD]]
+
* [[RIBOKIN-RXN]]
* [[IMIDPHOSDEHYD-RXN]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
* [[RXN-17900]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-erythro-imidazole-glycerol-phosphate}}
+
{{#set: common-name=α-d-ribofuranose}}
{{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}}
+
{{#set: inchi-key=inchikey=hmfhbzshggewlo-aihaylrmsa-n}}
{{#set: molecular-weight=236.121}}
+
{{#set: molecular-weight=150.131}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-10330

  • common-name:
    • α-d-ribofuranose
  • smiles:
    • c(c1(c(c(c(o1)o)o)o))o
  • inchi-key:
    • hmfhbzshggewlo-aihaylrmsa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality