Difference between revisions of "Chalcones"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite ACETOL == * common-name: ** acetol * smiles: ** cc(=o)co * inchi-key: ** xlsmfkstngkwqx-uhfffaoysa-n * molecular-weight: ** 74.079 == Rea...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACETOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** acetol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xlsmfkstngkwqx-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 74.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17625]] |
| − | + | * [[RXN-17627]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17627]] |
| − | + | * [[RXN-8630]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=acetol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xlsmfkstngkwqx-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.079}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite ACETOL
- common-name:
- acetol
- smiles:
- cc(=o)co
- inchi-key:
- xlsmfkstngkwqx-uhfffaoysa-n
- molecular-weight:
- 74.079
