Difference between revisions of "Charged-ALA-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9956 == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)...")
(Created page with "Category:metabolite == Metabolite Charged-ALA-tRNAs == * common-name: ** an l-alanyl-[trnaala] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9956 ==
+
== Metabolite Charged-ALA-tRNAs ==
 
* common-name:
 
* common-name:
** ubiquinol-8
+
** an l-alanyl-[trnaala]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** lojuqfspyhmheo-sghxuwjisa-n
 
* molecular-weight:
 
** 729.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R00281]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DHHB-METHYLTRANSFER-RXN]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
* [[R00281]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-8}}
+
{{#set: common-name=an l-alanyl-[trnaala]}}
{{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}}
 
{{#set: molecular-weight=729.137}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Charged-ALA-tRNAs

  • common-name:
    • an l-alanyl-[trnaala]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-alanyl-[trnaala" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.