Difference between revisions of "Charged-ALA-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...")
(Created page with "Category:metabolite == Metabolite CPD-9956 == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEAMIDO-NAD ==
+
== Metabolite CPD-9956 ==
 
* common-name:
 
* common-name:
** nicotinate adenine dinucleotide
+
** ubiquinol-8
 
* smiles:
 
* smiles:
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
* inchi-key:
** senpvezbrzqvst-hisdbwnosa-l
+
** lojuqfspyhmheo-sghxuwjisa-n
 
* molecular-weight:
 
* molecular-weight:
** 662.399
+
** 729.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAD-SYNTH-GLN-RXN]]
+
* [[R00281]]
* [[NAD-SYNTH-NH3-RXN]]
+
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[DHHB-METHYLTRANSFER-RXN]]
 +
* [[R00281]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nicotinate adenine dinucleotide}}
+
{{#set: common-name=ubiquinol-8}}
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
+
{{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}}
{{#set: molecular-weight=662.399}}
+
{{#set: molecular-weight=729.137}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-9956

  • common-name:
    • ubiquinol-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • lojuqfspyhmheo-sghxuwjisa-n
  • molecular-weight:
    • 729.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality