Difference between revisions of "Charged-ARG-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15431 == * common-name: ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-un...")
(Created page with "Category:metabolite == Metabolite Charged-ARG-tRNAs == * common-name: ** an l-arginyl-[trnaarg] == Reaction(s) known to consume the compound == * [[ARGINYLTRANSFERASE-RXN]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15431 ==
+
== Metabolite Charged-ARG-tRNAs ==
 
* common-name:
 
* common-name:
** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
+
** an l-arginyl-[trnaarg]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c
 
* inchi-key:
 
** sgclprbyahbrpd-qozjjacasa-l
 
* molecular-weight:
 
** 1331.648
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14561]]
+
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[RXN-17888]]
 +
* [[RXN-17889]]
 +
* [[RXN-17890]]
 +
* [[RXN-17891]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}}
+
{{#set: common-name=an l-arginyl-[trnaarg]}}
{{#set: inchi-key=inchikey=sgclprbyahbrpd-qozjjacasa-l}}
 
{{#set: molecular-weight=1331.648}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Charged-ARG-tRNAs

  • common-name:
    • an l-arginyl-[trnaarg]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-arginyl-[trnaarg" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.