Difference between revisions of "Charged-ARG-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-804 == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hnoajoyerzts...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-DiMeGua-26-DiMeGua27 == * common-name: ** an n2-dimethylguanine26/n2-dimethylguanine27 == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-804 ==
+
== Metabolite tRNA-Containing-N2-DiMeGua-26-DiMeGua27 ==
 
* common-name:
 
* common-name:
** (4s)-4-hydroxy-2-oxoheptanedioate
+
** an n2-dimethylguanine26/n2-dimethylguanine27
* smiles:
 
** c(ccc(o)cc(c([o-])=o)=o)([o-])=o
 
* inchi-key:
 
** hnoajoyerztsnk-bypyzucnsa-l
 
* molecular-weight:
 
** 188.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12381]]
 +
* [[RXN-12382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-4-hydroxy-2-oxoheptanedioate}}
+
{{#set: common-name=an n2-dimethylguanine26/n2-dimethylguanine27}}
{{#set: inchi-key=inchikey=hnoajoyerztsnk-bypyzucnsa-l}}
 
{{#set: molecular-weight=188.137}}
 

Revision as of 15:28, 5 January 2021

Metabolite tRNA-Containing-N2-DiMeGua-26-DiMeGua27

  • common-name:
    • an n2-dimethylguanine26/n2-dimethylguanine27

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality