Difference between revisions of "Charged-ASN-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite b-Hydroxy-cis-D5-dodecenoyl-ACPs == * common-name: ** a (3r,5z)-3-hydroxy-dodec-5-enoyl-[acp] == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc(o)(co)c(o)cop(op([o-])(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol |
+ | * smiles: | ||
+ | ** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o | ||
+ | * inchi-key: | ||
+ | ** yfaukwznpvbcff-xhibxcghsa-l | ||
+ | * molecular-weight: | ||
+ | ** 519.295 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.1.148-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.7.60-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}} |
+ | {{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}} | ||
+ | {{#set: molecular-weight=519.295}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C
- common-name:
- 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
- smiles:
- cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
- inchi-key:
- yfaukwznpvbcff-xhibxcghsa-l
- molecular-weight:
- 519.295