Difference between revisions of "Charged-ASP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Charged-ASP-tRNAs == * common-name: ** an l-aspartyl-[trnaasp] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Charged-ASP-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-aspartyl-[trnaasp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ASPARTATE--TRNA-LIGASE-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-aspartyl-[trnaasp]}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Charged-ASP-tRNAs
- common-name:
- an l-aspartyl-[trnaasp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.