Difference between revisions of "Charged-ASP-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...")
(Created page with "Category:metabolite == Metabolite Charged-ASP-tRNAs == * common-name: ** an l-aspartyl-[trnaasp] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8291 ==
+
== Metabolite Charged-ASP-tRNAs ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** an l-aspartyl-[trnaasp]
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
 
* inchi-key:
 
** mwrbnpkjoowzpw-nyvomtagsa-n
 
* molecular-weight:
 
** 744.043
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
 
* [[RXN-15067]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=an l-aspartyl-[trnaasp]}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
 
{{#set: molecular-weight=744.043}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Charged-ASP-tRNAs

  • common-name:
    • an l-aspartyl-[trnaasp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.