Difference between revisions of "Charged-ASP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11608 == * common-name: ** β-sitosterol 3-o-β-d-glucoside * smiles: ** ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(...") |
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8291 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:1-2-18:1-phosphatidylethanolamine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mwrbnpkjoowzpw-nyvomtagsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 744.043 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15036]] | ||
| + | * [[RXN-15067]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15036]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=744.043}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-8291
- common-name:
- 1-18:1-2-18:1-phosphatidylethanolamine
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
- inchi-key:
- mwrbnpkjoowzpw-nyvomtagsa-n
- molecular-weight:
- 744.043
