Difference between revisions of "Charged-CYS-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * common-name: ** β-nicotinamide d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c...")
(Created page with "Category:metabolite == Metabolite CPD-17624 == * common-name: ** ω-carboxy-(9z)-octadec-9-enoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINAMIDE_NUCLEOTIDE ==
+
== Metabolite CPD-17624 ==
 
* common-name:
 
* common-name:
** β-nicotinamide d-ribonucleotide
+
** ω-carboxy-(9z)-octadec-9-enoyl-coa
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** dayljwodmcoqew-turqnecasa-m
+
** iiswkvfhqlaomw-btfuzuoasa-i
 
* molecular-weight:
 
* molecular-weight:
** 333.214
+
** 1056.928
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.1-RXN]]
 
* [[RXN-5841]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-LIGASE-NAD+-RXN]]
+
* [[RXN-16418]]
* [[NADPYROPHOSPHAT-RXN]]
 
* [[RXN-17920]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=ω-carboxy-(9z)-octadec-9-enoyl-coa}}
{{#set: inchi-key=inchikey=dayljwodmcoqew-turqnecasa-m}}
+
{{#set: inchi-key=inchikey=iiswkvfhqlaomw-btfuzuoasa-i}}
{{#set: molecular-weight=333.214}}
+
{{#set: molecular-weight=1056.928}}

Revision as of 18:52, 14 January 2021

Metabolite CPD-17624

  • common-name:
    • ω-carboxy-(9z)-octadec-9-enoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • iiswkvfhqlaomw-btfuzuoasa-i
  • molecular-weight:
    • 1056.928

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality