Difference between revisions of "Charged-GLT-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([...")
(Created page with "Category:metabolite == Metabolite Charged-GLT-tRNAs == * common-name: ** an l-glutamyl-[trnaglu] == Reaction(s) known to consume the compound == * GLUTRNAREDUCT-RXN ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OH-HEXANOYL-COA ==
+
== Metabolite Charged-GLT-tRNAs ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxyhexanoyl-coa
+
** an l-glutamyl-[trnaglu]
* smiles:
 
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
** vaahkrmgofiorx-dwufxmdisa-j
 
* molecular-weight:
 
** 877.646
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
+
* [[GLUTRNAREDUCT-RXN]]
* [[HACD2h]]
 
* [[RXN-12567]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[GLURS-RXN]]
* [[HACD2h]]
 
* [[RXN-12570]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
+
{{#set: common-name=an l-glutamyl-[trnaglu]}}
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
 
{{#set: molecular-weight=877.646}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Charged-GLT-tRNAs

  • common-name:
    • an l-glutamyl-[trnaglu]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-glutamyl-[trnaglu" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.