Difference between revisions of "Charged-LEU-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-LACTATE == * common-name: ** (s)-lactate * smiles: ** cc(c([o-])=o)o * inchi-key: ** jvtaaekczfnvcj-reohclbhsa-m * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-LACTATE ==
+
== Metabolite CPD-17348 ==
 
* common-name:
 
* common-name:
** (s)-lactate
+
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
 
* smiles:
 
* smiles:
** cc(c([o-])=o)o
+
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jvtaaekczfnvcj-reohclbhsa-m
+
** jlhullpftgligf-dbyuabgnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 89.071
+
** 1051.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-LACTATE-DEHYDROGENASE-RXN]]
+
* [[RXN-16097]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-LACTATE-DEHYDROGENASE-RXN]]
+
* [[RXN-16096]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-lactate}}
+
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
{{#set: inchi-key=inchikey=jvtaaekczfnvcj-reohclbhsa-m}}
+
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
{{#set: molecular-weight=89.071}}
+
{{#set: molecular-weight=1051.975}}

Revision as of 08:32, 15 March 2021

Metabolite CPD-17348

  • common-name:
    • (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jlhullpftgligf-dbyuabgnsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality