Difference between revisions of "Charged-LEU-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
(Created page with "Category:metabolite == Metabolite Charged-LEU-tRNAs == * common-name: ** an l-leucyl-[trnaleu] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17348 ==
+
== Metabolite Charged-LEU-tRNAs ==
 
* common-name:
 
* common-name:
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+
** an l-leucyl-[trnaleu]
* smiles:
 
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jlhullpftgligf-dbyuabgnsa-j
 
* molecular-weight:
 
** 1051.975
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16097]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16096]]
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
+
{{#set: common-name=an l-leucyl-[trnaleu]}}
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
 
{{#set: molecular-weight=1051.975}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite Charged-LEU-tRNAs

  • common-name:
    • an l-leucyl-[trnaleu]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-leucyl-[trnaleu" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.