Difference between revisions of "Charged-LEU-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Alcohols == * common-name: ** an alcohol == Reaction(s) known to consume the compound == * ALCOHOL-DEHYDROGENASE-NADP+-RXN == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-8081 == * common-name: ** 1-18:3-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Alcohols ==
+
== Metabolite CPD-8081 ==
 
* common-name:
 
* common-name:
** an alcohol
+
** 1-18:3-2-18:3-digalactosyldiacylglycerol
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 +
* inchi-key:
 +
** kdyapqvyjxuqny-ncuixijtsa-n
 +
* molecular-weight:
 +
** 937.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.15-RXN]]
+
* [[RXN-8311]]
* [[3.2.1.52-RXN]]
+
* [[RXN-8314]]
* [[ACID-PHOSPHATASE-RXN]]
 
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 
* [[ALKAPHOSPHA-RXN]]
 
* [[BETA-L-ARABINOSIDASE-RXN]]
 
* [[CARBOXYLESTERASE-RXN]]
 
* [[GLYCPDIESTER-RXN]]
 
* [[RXN-12615]]
 
* [[RXN0-5468]]
 
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an alcohol}}
+
{{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}}
 +
{{#set: molecular-weight=937.216}}

Revision as of 15:31, 5 January 2021

Metabolite CPD-8081

  • common-name:
    • 1-18:3-2-18:3-digalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • kdyapqvyjxuqny-ncuixijtsa-n
  • molecular-weight:
    • 937.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality