Difference between revisions of "Charged-LEU-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8081 == * common-name: ** 1-18:3-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite Delta-14-steroids == * common-name: ** a δ14steroid == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8081 ==
+
== Metabolite Delta-14-steroids ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:3-digalactosyldiacylglycerol
+
** a δ14steroid
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
** kdyapqvyjxuqny-ncuixijtsa-n
 
* molecular-weight:
 
** 937.216
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8311]]
+
* [[RXN-13961]]
* [[RXN-8314]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}}
+
{{#set: common-name=a δ14steroid}}
{{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}}
 
{{#set: molecular-weight=937.216}}
 

Revision as of 13:13, 14 January 2021

Metabolite Delta-14-steroids

  • common-name:
    • a δ14steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality