Difference between revisions of "Charged-PHE-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
(Created page with "Category:metabolite == Metabolite Charged-PHE-tRNAs == * common-name: ** an l-phenylalanyl-[trnaphe] == Reaction(s) known to consume the compound == == Reaction(s) known t...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
+
== Metabolite Charged-PHE-tRNAs ==
 
* common-name:
 
* common-name:
** 2,4-dinitrophenyl-s-glutathione
+
** an l-phenylalanyl-[trnaphe]
* smiles:
 
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 
* inchi-key:
 
** fxeukvkgtkddiq-uwvggrqhsa-m
 
* molecular-weight:
 
** 472.406
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
+
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
+
{{#set: common-name=an l-phenylalanyl-[trnaphe]}}
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
 
{{#set: molecular-weight=472.406}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Charged-PHE-tRNAs

  • common-name:
    • an l-phenylalanyl-[trnaphe]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-phenylalanyl-[trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.