Difference between revisions of "Charged-SEC-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHONDROITIN-4-SULFATE == * common-name: ** [chondroitin]-4-o-sulfo-n-acetylgalactosamine == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PARAOXON == |
* common-name: | * common-name: | ||
− | ** [ | + | ** paraoxon |
+ | * smiles: | ||
+ | ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o | ||
+ | * inchi-key: | ||
+ | ** wymsbxtxohuigt-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 275.197 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-8746]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=paraoxon}} |
+ | {{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=275.197}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite PARAOXON
- common-name:
- paraoxon
- smiles:
- ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
- inchi-key:
- wymsbxtxohuigt-uhfffaoysa-n
- molecular-weight:
- 275.197