Difference between revisions of "Charged-SEC-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N3-methyluracil1498 == * common-name: ** an n3-methyluracil1498 in 16s rrna == Reaction(s) known to consume the compound == == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16S-rRNA-N3-methyluracil1498 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n3-methyluracil1498 in 16s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11598]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n3-methyluracil1498 in 16s rrna}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite 16S-rRNA-N3-methyluracil1498
- common-name:
- an n3-methyluracil1498 in 16s rrna
