Difference between revisions of "Charged-TRP-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08104 == * transcription-direction: ** positive * right-end-position: ** 10319 * left-end-position: ** 4210 * centisome-position: ** 0.94575715...")
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ08104 ==
+
== Metabolite CPD-5662 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 9-mercaptodethiobiotin
−
* right-end-position:
+
* smiles:
−
** 10319
+
** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
−
* left-end-position:
+
* inchi-key:
−
** 4210
+
** zarfdbykhcotrh-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 0.94575715   
+
** 245.316
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17473]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
* [[RXN-17472]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=9-mercaptodethiobiotin}}
−
* [[PROPIONYL-COA-CARBOXY-RXN]]
+
{{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=245.316}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN1G-4355]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[LEU-DEG2-PWY]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5789]]
 
−
** '''8''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-5743]]
 
−
** '''5''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PROPIONMET-PWY]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6728]]
 
−
** '''11''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-7384]]
 
−
** '''6''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWYG-321]]
 
−
** '''26''' reactions found over '''182''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=10319}}
 
−
{{#set: left-end-position=4210}}
 
−
{{#set: centisome-position=0.94575715    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-5662

  • common-name:
    • 9-mercaptodethiobiotin
  • smiles:
    • c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
  • inchi-key:
    • zarfdbykhcotrh-uhfffaoysa-m
  • molecular-weight:
    • 245.316

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Charged-TRP-tRNAs&oldid=46298"