Difference between revisions of "Charged-TRP-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...")
(Created page with "Category:metabolite == Metabolite CPD-14281 == * common-name: ** trans-docos-2-enoyl-coa * smiles: ** cccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9245 ==
+
== Metabolite CPD-14281 ==
 
* common-name:
 
* common-name:
** palmitoleate
+
** trans-docos-2-enoyl-coa
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)[o-]
+
** cccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** secpzkhbenqxjg-fplpwbnlsa-m
+
** krtifnfqcjtgmv-dyavhemfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 253.404
+
** 1084.06
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-7248]]
+
* [[RXN-13307]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10662]]
+
* [[RXN-13303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleate}}
+
{{#set: common-name=trans-docos-2-enoyl-coa}}
{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
+
{{#set: inchi-key=inchikey=krtifnfqcjtgmv-dyavhemfsa-j}}
{{#set: molecular-weight=253.404}}
+
{{#set: molecular-weight=1084.06}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-14281

  • common-name:
    • trans-docos-2-enoyl-coa
  • smiles:
    • cccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • krtifnfqcjtgmv-dyavhemfsa-j
  • molecular-weight:
    • 1084.06

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality