Difference between revisions of "Charged-VAL-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTHIOCYS-RXN CYSTHIOCYS-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expa...") |
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SUCROSE == |
− | * | + | * common-name: |
− | ** | + | ** sucrose |
− | * | + | * smiles: |
− | ** | + | ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o |
− | + | * inchi-key: | |
− | + | ** czmrcdwagmrecn-ugdnzrgbsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 342.299 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[2.4.1.82-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11502]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=sucrose}} |
− | * | + | {{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}} |
− | + | {{#set: molecular-weight=342.299}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Revision as of 20:35, 18 December 2020
Contents
Metabolite SUCROSE
- common-name:
- sucrose
- smiles:
- c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
- inchi-key:
- czmrcdwagmrecn-ugdnzrgbsa-n
- molecular-weight:
- 342.299