Difference between revisions of "Charged-fMET-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-318 == * common-name: ** monodehydroascorbate radical * smiles: ** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1) * inchi-key: ** lhfjobmtajjotb-jla...")
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-318 ==
+
== Metabolite CPD-19169 ==
 
* common-name:
 
* common-name:
** monodehydroascorbate radical
+
** 3-oxo-(9z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1)
+
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lhfjobmtajjotb-jlaznsocsa-n
+
** aveyykdekgjvbu-bpmmelmssa-j
 
* molecular-weight:
 
* molecular-weight:
** 175.118
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.6.5.4-RXN]]
+
* [[RXN-17778]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15598]]
+
* [[RXN-17777]]
* [[RXN-3521]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=monodehydroascorbate radical}}
+
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=lhfjobmtajjotb-jlaznsocsa-n}}
+
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
{{#set: molecular-weight=175.118}}
+
{{#set: molecular-weight=1041.936}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-19169

  • common-name:
    • 3-oxo-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • aveyykdekgjvbu-bpmmelmssa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality