Difference between revisions of "Chitodextrins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * smiles: ** cc(=o)c(o)cop(=o)([o-])[o-] * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Chitodextrins == * common-name: ** a chitodextrin == Reaction(s) known to consume the compound == * RXN-12623 * RXN-12624 == Reac...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Chitodextrins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a chitodextrin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12623]] |
| + | * [[RXN-12624]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a chitodextrin}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Chitodextrins
- common-name:
- a chitodextrin
