Difference between revisions of "Chitosan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-glycine == * common-name: ** an n-terminal glycyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD-8083 == * common-name: ** 1-18:2-2-18:3-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-glycine ==
+
== Metabolite CPD-8083 ==
 
* common-name:
 
* common-name:
** an n-terminal glycyl-[protein]
+
** 1-18:2-2-18:3-digalactosyldiacylglycerol
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 +
* inchi-key:
 +
** gkshydzifvnlss-ipdwfasdsa-n
 +
* molecular-weight:
 +
** 939.231
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8314]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17875]]
+
* [[RXN-8313]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal glycyl-[protein]}}
+
{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
 +
{{#set: molecular-weight=939.231}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-8083

  • common-name:
    • 1-18:2-2-18:3-digalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • gkshydzifvnlss-ipdwfasdsa-n
  • molecular-weight:
    • 939.231

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality