Difference between revisions of "Cis-19-CP-37-Mex-38-Me-C59-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Mannosyl9-Nacetylglucosaminyl2 == == Reaction(s) known to consume the compound == * 3.2.1.113-RXN == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite CPD-208 == * common-name: ** (s)-malyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Mannosyl9-Nacetylglucosaminyl2 ==
+
== Metabolite CPD-208 ==
 +
* common-name:
 +
** (s)-malyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** hjqwlhmlmcdael-ztgltyrusa-i
 +
* molecular-weight:
 +
** 878.568
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.113-RXN]]
+
* [[RXN-14937]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(s)-malyl-coa}}
 +
{{#set: inchi-key=inchikey=hjqwlhmlmcdael-ztgltyrusa-i}}
 +
{{#set: molecular-weight=878.568}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-208

  • common-name:
    • (s)-malyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hjqwlhmlmcdael-ztgltyrusa-i
  • molecular-weight:
    • 878.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality