Difference between revisions of "Cis-19-CP-37-Mex-38-Me-C59-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * smiles:...")
(Created page with "Category:metabolite == Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs == * common-name: ** a cis-methoxy-c59-meroacyl-[acp] == Reaction(s) known to consume the compound == ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite C1 ==
+
== Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs ==
 
* common-name:
 
* common-name:
−
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** a cis-methoxy-c59-meroacyl-[acp]
−
* smiles:
 
−
** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o)
 
−
* inchi-key:
 
−
** imwoxezvyqdrdf-mczxnmlpsa-j
 
−
* molecular-weight:
 
−
** 1189.924
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[PHOSNACMURPENTATRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-2544]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=a cis-methoxy-c59-meroacyl-[acp]}}
−
{{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}}
 
−
{{#set: molecular-weight=1189.924}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs

  • common-name:
    • a cis-methoxy-c59-meroacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-methoxy-c59-meroacyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Cis-19-CP-37-Mex-38-Me-C59-ACPs&oldid=137347"