Difference between revisions of "Cis-19-CP-37-Mex-38-Me-C59-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-208 == * common-name: ** (s)-malyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-1130 == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o * inchi-key: ** jucrenbzzqkfgk-uhfffaoysa-l * molecu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-208 ==
+
== Metabolite CPD-1130 ==
 
* common-name:
 
* common-name:
−
** (s)-malyl-coa
+
** 3-ethylmalate
 
* smiles:
 
* smiles:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc(c([o-])=o)c(c(=o)[o-])o
 
* inchi-key:
 
* inchi-key:
−
** hjqwlhmlmcdael-ztgltyrusa-i
+
** jucrenbzzqkfgk-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 878.568
+
** 160.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14937]]
+
* [[RXN-14986]]
 +
* [[RXN-18210]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(s)-malyl-coa}}
+
{{#set: common-name=3-ethylmalate}}
−
{{#set: inchi-key=inchikey=hjqwlhmlmcdael-ztgltyrusa-i}}
+
{{#set: inchi-key=inchikey=jucrenbzzqkfgk-uhfffaoysa-l}}
−
{{#set: molecular-weight=878.568}}
+
{{#set: molecular-weight=160.126}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-1130

  • common-name:
    • 3-ethylmalate
  • smiles:
    • ccc(c([o-])=o)c(c(=o)[o-])o
  • inchi-key:
    • jucrenbzzqkfgk-uhfffaoysa-l
  • molecular-weight:
    • 160.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Cis-19-CP-37-Mex-38-Me-C59-ACPs&oldid=72217"