Difference between revisions of "Cis-19-CP-37-Mex-38-Me-C59-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1130 == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o * inchi-key: ** jucrenbzzqkfgk-uhfffaoysa-l * molecu...") |
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C1 == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine |
* smiles: | * smiles: | ||
− | ** ccc(c([o-])=o)c(c(=o)[o-])o | + | ** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** imwoxezvyqdrdf-mczxnmlpsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1189.924 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PHOSNACMURPENTATRANS-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1189.924}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite C1
- common-name:
- udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
- smiles:
- cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o)
- inchi-key:
- imwoxezvyqdrdf-mczxnmlpsa-j
- molecular-weight:
- 1189.924