Difference between revisions of "Cis-5-enoyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-15237 == * common-name: ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate == Reaction(s) known to consume the compound =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15237 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-14361]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate}} |
| − | |||
| − | |||
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-15237
- common-name:
- glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate
