Difference between revisions of "Cis-D21-39-oxo-40-Me-C59-1-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTANOL == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxekiibdnhejcq-uhfffaoysa-n * molecular-weight: ** 74.122...")
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ISOBUTANOL ==
+
== Metabolite DGTP ==
 
* common-name:
 
* common-name:
** isobutanol
+
** dgtp
 
* smiles:
 
* smiles:
** cc(c)co
+
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** zxekiibdnhejcq-uhfffaoysa-n
+
** haazlughyhwqiw-kvqbguixsa-j
 
* molecular-weight:
 
* molecular-weight:
** 74.122
+
** 503.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7657]]
+
* [[DGTCY]]
 +
* [[DGTD]]
 +
* [[DGTPTRIPHYDRO-RXN]]
 +
* [[DGTPtm]]
 +
* [[DGTUP]]
 +
* [[RXN-14208]]
 +
* [[RXN-14217]]
 +
* [[RXN0-385]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7657]]
+
* [[ATDGD]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DGTPtm]]
 +
* [[RXN-14207]]
 +
* [[RXN0-746]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isobutanol}}
+
{{#set: common-name=dgtp}}
{{#set: inchi-key=inchikey=zxekiibdnhejcq-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
{{#set: molecular-weight=74.122}}
+
{{#set: molecular-weight=503.152}}

Revision as of 15:29, 5 January 2021

Metabolite DGTP

  • common-name:
    • dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • haazlughyhwqiw-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality