Difference between revisions of "Cis-Delta5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17329 == * common-name: ** 3-oxo-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)co...")
(Created page with "Category:metabolite == Metabolite Cis-Delta5-dodecenoyl-ACPs == * common-name: ** a (5z)-dodec-5-enoyl-[acp] == Reaction(s) known to consume the compound == * [[RXN-10654]...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17329 ==
+
== Metabolite Cis-Delta5-dodecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** 3-oxo-tetracosatetraenoyl-coa
+
** a (5z)-dodec-5-enoyl-[acp]
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** wsalicwlarpulc-gjykhrjnsa-j
 
* molecular-weight:
 
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17109]]
+
* [[RXN-10654]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2145]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-tetracosatetraenoyl-coa}}
+
{{#set: common-name=a (5z)-dodec-5-enoyl-[acp]}}
{{#set: inchi-key=inchikey=wsalicwlarpulc-gjykhrjnsa-j}}
 
{{#set: molecular-weight=1120.05}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Cis-Delta5-dodecenoyl-ACPs

  • common-name:
    • a (5z)-dodec-5-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (5z)-dodec-5-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.