Difference between revisions of "Cis-Delta7-tetradecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-169 RXN66-169] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 4-hydroxyphenylpyruvate * smiles: ** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o) * inchi-key: ** kkad...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-169 RXN66-169] ==
+
== Metabolite P-HYDROXY-PHENYLPYRUVATE ==
* direction:
+
* common-name:
** left-to-right
+
** 4-hydroxyphenylpyruvate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.14.1 ec-1.14.14.1]
+
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-2742]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[CPD-3188]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
+
** kkadpxvioxhvkn-uhfffaoysa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18127]]
+
** 179.152
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
* Gene: [[SJ19505]]
+
* [[HPPD]]
** Category: [[orthology]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ12861]]
+
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
** Category: [[orthology]]
+
* [[PREPHENATEDEHYDROG-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
+
{{#set: common-name=4-hydroxyphenylpyruvate}}
** '''5''' reactions found over '''18''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
== Reconstruction information  ==
+
{{#set: molecular-weight=179.152}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.14.14.1}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:36, 18 December 2020

Metabolite P-HYDROXY-PHENYLPYRUVATE

  • common-name:
    • 4-hydroxyphenylpyruvate
  • smiles:
    • c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
  • inchi-key:
    • kkadpxvioxhvkn-uhfffaoysa-m
  • molecular-weight:
    • 179.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality