Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-...")
(Created page with "Category:metabolite == Metabolite CPD-706 == * common-name: ** 24-methylenecholesterol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-464 ==
+
== Metabolite CPD-706 ==
 
* common-name:
 
* common-name:
** prephytoene diphosphate
+
** 24-methylenecholesterol
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** rvcnktpchznaao-imslgmfesa-k
+
** indvlxyucbvvkw-pxbbazsnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 719.897
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNARA-8002]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.32-RXN]]
+
* [[RXN-707]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prephytoene diphosphate}}
+
{{#set: common-name=24-methylenecholesterol}}
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
+
{{#set: inchi-key=inchikey=indvlxyucbvvkw-pxbbazsnsa-n}}
{{#set: molecular-weight=719.897}}
+
{{#set: molecular-weight=398.671}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-706

  • common-name:
    • 24-methylenecholesterol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • indvlxyucbvvkw-pxbbazsnsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality