Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-...")
(Created page with "Category:metabolite == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == * common-name: ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] == Reaction(s) known to consume the com...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-464 ==
+
== Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs ==
 
* common-name:
 
* common-name:
** prephytoene diphosphate
+
** a cis,cis-delta17,35-3-hydroxyc54:2-[acp]
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
 
* inchi-key:
 
** rvcnktpchznaao-imslgmfesa-k
 
* molecular-weight:
 
** 719.897
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNARA-8002]]
+
* [[RXN1G-220]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.32-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prephytoene diphosphate}}
+
{{#set: common-name=a cis,cis-delta17,35-3-hydroxyc54:2-[acp]}}
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
 
{{#set: molecular-weight=719.897}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs

  • common-name:
    • a cis,cis-delta17,35-3-hydroxyc54:2-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis,cis-delta17,35-3-hydroxyc54:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.