Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Histone-N-o-methyl-arginines == * common-name: ** [histone]-nω-methyl-arginine == Reaction(s) known to consume the compound == == R...") |
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LINOLEIC_ACID == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** linoleate |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccccccccc([o-])=o | ||
| + | * inchi-key: | ||
| + | ** oyhqolukzrvurq-hzjyttrnsa-m | ||
| + | * molecular-weight: | ||
| + | ** 279.442 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[LIPOXYGENASE-RXN]] | ||
| + | * [[LNLCCOAL]] | ||
| + | * [[RXN-9673]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FACOAE182]] |
| + | * [[LINOLEOYL-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=linoleate}} |
| + | {{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}} | ||
| + | {{#set: molecular-weight=279.442}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite LINOLEIC_ACID
- common-name:
- linoleate
- smiles:
- cccccc=ccc=ccccccccc([o-])=o
- inchi-key:
- oyhqolukzrvurq-hzjyttrnsa-m
- molecular-weight:
- 279.442
