Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RH-Group == |
* common-name: | * common-name: | ||
| − | ** | + | ** an organic molecule |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12615]] |
| − | + | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | |
| − | * [[RXN | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an organic molecule}} |
| − | |||
| − | |||
Revision as of 15:26, 5 January 2021
Contents
Metabolite RH-Group
- common-name:
- an organic molecule
