Difference between revisions of "Cis-cis-D17-35-3-hydroxyC54-2-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...") |
(Created page with "Category:metabolite == Metabolite CPD-14675 == * common-name: ** pristanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14675 == |
* common-name: | * common-name: | ||
− | ** | + | ** pristanoyl-coa |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** xyjpsqpvcbnzht-tukysrjdsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1043.995 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-484]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pristanoyl-coa}} |
+ | {{#set: inchi-key=inchikey=xyjpsqpvcbnzht-tukysrjdsa-j}} | ||
+ | {{#set: molecular-weight=1043.995}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-14675
- common-name:
- pristanoyl-coa
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xyjpsqpvcbnzht-tukysrjdsa-j
- molecular-weight:
- 1043.995