Difference between revisions of "Cis-delta-3-decenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...") |
(Created page with "Category:metabolite == Metabolite Cis-delta-3-decenoyl-ACPs == * common-name: ** a (3z)-dec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN0-2141 =...") |
||
(3 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Cis-delta-3-decenoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** ( | + | ** a (3z)-dec-3-enoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-2141]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=a (3z)-dec-3-enoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Cis-delta-3-decenoyl-ACPs
- common-name:
- a (3z)-dec-3-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3z)-dec-3-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.