Difference between revisions of "Cleaved-type-1-transmembrane-domains"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite Cleaved-type-1-transmembrane-domains == * common-name: ** cleaved type-1 transmembrane proteins == Reaction(s) known to consume the compo...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12676 ==
+
== Metabolite Cleaved-type-1-transmembrane-domains ==
 
* common-name:
 
* common-name:
** 5'-chloro-5'-deoxyadenosine
+
** cleaved type-1 transmembrane proteins
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
 
* inchi-key:
 
** iysnpomtkfzdhz-kqynxxcusa-n
 
* molecular-weight:
 
** 285.689
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11715]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.21.105-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5'-chloro-5'-deoxyadenosine}}
+
{{#set: common-name=cleaved type-1 transmembrane proteins}}
{{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}}
 
{{#set: molecular-weight=285.689}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Cleaved-type-1-transmembrane-domains

  • common-name:
    • cleaved type-1 transmembrane proteins

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality