Difference between revisions of "Core1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...")
(Created page with "Category:metabolite == Metabolite DIMETHYLARSINATE == * common-name: ** cacodylate * smiles: ** c[as](c)(=o)[o-] * inchi-key: ** oggxgzamxpvrfz-uhfffaoysa-m * molecular-we...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite DIMETHYLARSINATE ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** cacodylate
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** c[as](c)(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ayekofbpnlcajy-uhfffaoysa-l
+
** oggxgzamxpvrfz-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 422.288
+
** 136.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PDHam2hi]]
+
* [[2.1.1.138-RXN]]
* [[PDHam2mi]]
 
* [[RXN-12508]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=cacodylate}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=oggxgzamxpvrfz-uhfffaoysa-m}}
{{#set: molecular-weight=422.288}}
+
{{#set: molecular-weight=136.99}}

Revision as of 18:59, 14 January 2021

Metabolite DIMETHYLARSINATE

  • common-name:
    • cacodylate
  • smiles:
    • c[as](c)(=o)[o-]
  • inchi-key:
    • oggxgzamxpvrfz-uhfffaoysa-m
  • molecular-weight:
    • 136.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality