Difference between revisions of "Core1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...")
(Created page with "Category:metabolite == Metabolite Core1 == * common-name: ** core 1 == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 2.4...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite Core1 ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** core 1
* smiles:
 
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
** ayekofbpnlcajy-uhfffaoysa-l
 
* molecular-weight:
 
** 422.288
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PDHam2hi]]
+
* [[2.4.1.122-RXN]]
* [[PDHam2mi]]
 
* [[RXN-12508]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=core 1}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
 
{{#set: molecular-weight=422.288}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite Core1

  • common-name:
    • core 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality