Difference between revisions of "Crotonyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine == * common-name: ** a [hect-type e3 ubiquitin transferase]-s-ubiquitinyl-l-cysteine == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite PRISTANATE == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PRISTANATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** pristanate |
| + | * smiles: | ||
| + | ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c | ||
| + | * inchi-key: | ||
| + | ** pahgjzdqxioyth-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 297.5 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-484]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pristanate}} |
| + | {{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=297.5}} | ||
Revision as of 11:19, 15 January 2021
Contents
Metabolite PRISTANATE
- common-name:
- pristanate
- smiles:
- cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
- inchi-key:
- pahgjzdqxioyth-uhfffaoysa-m
- molecular-weight:
- 297.5
