Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15016 == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([o-])=o)c(c([o-])=o)o * inchi-key: ** wxskvkpsmahcsg-r...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-2-methyladenine2503 == * common-name: ** a 2-methyladenine2503 in 23s rrna == Reaction(s) known to consume the compound == == Re...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23S-rRNA-2-methyladenine2503 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2-methyladenine2503 in 23s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11586]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2-methyladenine2503 in 23s rrna}} |
− | |||
− |
Revision as of 18:59, 14 January 2021
Contents
Metabolite 23S-rRNA-2-methyladenine2503
- common-name:
- a 2-methyladenine2503 in 23s rrna