Difference between revisions of "Cyclic-2-3-Ribonucleoside-Monophosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * smiles: ** cc(cc([o-])=o)o * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ENOL-OXALOACETATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** enol-oxaloacetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c(o)=cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uwyvpfmhmjibhe-uphrsurjsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 130.057 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OXALOACETATE-TAUTOMERASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=enol-oxaloacetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=130.057}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite ENOL-OXALOACETATE
- common-name:
- enol-oxaloacetate
- smiles:
- c([o-])(=o)c(o)=cc(=o)[o-]
- inchi-key:
- uwyvpfmhmjibhe-uphrsurjsa-l
- molecular-weight:
- 130.057
