Difference between revisions of "Cyclic-3-5-Nucleoside-Monophosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite tRNA-precursors == * common-name: ** a trna precursor == Reaction(s) known to consume the compound == * 3.1.26.11-RXN * TRNA-CYTIDY...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12904 ==
+
== Metabolite tRNA-precursors ==
 
* common-name:
 
* common-name:
** (2e)-5-methylhexa-2,4-dienoyl-coa
+
** a trna precursor
* smiles:
 
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** ifmyvrqehqtins-meoyllpmsa-j
 
* molecular-weight:
 
** 871.642
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11919]]
+
* [[3.1.26.11-RXN]]
 +
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
+
{{#set: common-name=a trna precursor}}
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
 
{{#set: molecular-weight=871.642}}
 

Revision as of 08:28, 15 March 2021

Metabolite tRNA-precursors

  • common-name:
    • a trna precursor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality