Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XLFG-Xyloglucans == * common-name: ** an xlfg xylogulcan == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XLFG-Xyloglucans ==
+
== Metabolite CPD-15318 ==
 
* common-name:
 
* common-name:
** an xlfg xylogulcan
+
** α-d-ribose 5-phosphate
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
 +
* inchi-key:
 +
** ktvpxoyakdprhy-aihaylrmsa-l
 +
* molecular-weight:
 +
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R5PDP]]
 +
* [[RPDPK]]
 +
* [[RXN-14456]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9463]]
+
* [[ARDP]]
 +
* [[RIBOKIN-RXN]]
 +
* [[RPDPK]]
 +
* [[RXN-14456]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an xlfg xylogulcan}}
+
{{#set: common-name=α-d-ribose 5-phosphate}}
 +
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
 +
{{#set: molecular-weight=228.095}}

Revision as of 11:12, 15 January 2021

Metabolite CPD-15318

  • common-name:
    • α-d-ribose 5-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
  • inchi-key:
    • ktvpxoyakdprhy-aihaylrmsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality