Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...")
(Created page with "Category:metabolite == Metabolite 3-oxo-lignoceroyl-ACPs == * common-name: ** a 3-oxo-lignoceroyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-508 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15318 ==
+
== Metabolite 3-oxo-lignoceroyl-ACPs ==
 
* common-name:
 
* common-name:
** α-d-ribose 5-phosphate
+
** a 3-oxo-lignoceroyl-[acp]
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
 
* inchi-key:
 
** ktvpxoyakdprhy-aihaylrmsa-l
 
* molecular-weight:
 
** 228.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R5PDP]]
+
* [[RXN1G-508]]
* [[RPDPK]]
 
* [[RXN-14456]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARDP]]
+
* [[RXN1G-499]]
* [[RIBOKIN-RXN]]
 
* [[RPDPK]]
 
* [[RXN-14456]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose 5-phosphate}}
+
{{#set: common-name=a 3-oxo-lignoceroyl-[acp]}}
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Revision as of 08:24, 15 March 2021

Metabolite 3-oxo-lignoceroyl-ACPs

  • common-name:
    • a 3-oxo-lignoceroyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-lignoceroyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.