Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...") |
(Created page with "Category:metabolite == Metabolite 3-oxo-lignoceroyl-ACPs == * common-name: ** a 3-oxo-lignoceroyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-508 ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-oxo-lignoceroyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a 3-oxo-lignoceroyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1G-508]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1G-499]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-lignoceroyl-[acp]}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite 3-oxo-lignoceroyl-ACPs
- common-name:
- a 3-oxo-lignoceroyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-lignoceroyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.